C28H43IO2Si2 — CID 56931226
tert-butyl-[(E,3S)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-4-en-3-yl]oxy-diphenylsilane (PubChem CID 56931226) has the molecular formula C28H43IO2Si2 and a molecular weight of 594.73 g/mol. Its IUPAC name is tert-butyl-[(E,3S)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-4-en-3-yl]oxy-diphenylsilane.
| Compound Name | tert-butyl-[(E,3S)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-4-en-3-yl]oxy-diphenylsilane |
|---|---|
| PubChem CID | 56931226 |
| Molecular Formula | C28H43IO2Si2 |
| Molecular Weight | 594.73 g/mol |
| Exact Mass | 594.18 |
| IUPAC Name | tert-butyl-[(E,3S)-1-[tert-butyl(dimethyl)silyl]oxy-5-iodohex-4-en-3-yl]oxy-diphenylsilane |
| SMILES | C/C(I)=C\[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H43IO2Si2/c1-23(29)22-24(20-21-30-32(8,9)27(2,3)4)31-33(28(5,6)7,25-16-12-10-13-17-25)26-18-14-11-15-19-26/h10-19,22,24H,20-21H2,1-9H3/b23-22+/t24-/m0/s1 |
| InChIKey | MWZGZZYMLOHXQV-XAPOHKEGSA-N |
| XLogP | 7.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.73 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|