C34H52O4Si2 — CID 11250177
methyl (5S,6E,8Z)-11-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxyundeca-6,8-dienoate (PubChem CID 11250177) has the molecular formula C34H52O4Si2 and a molecular weight of 580.96 g/mol. Its IUPAC name is methyl (5S,6E,8Z)-11-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxyundeca-6,8-dienoate.
| Compound Name | methyl (5S,6E,8Z)-11-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxyundeca-6,8-dienoate |
|---|---|
| PubChem CID | 11250177 |
| Molecular Formula | C34H52O4Si2 |
| Molecular Weight | 580.96 g/mol |
| Exact Mass | 580.34 |
| IUPAC Name | methyl (5S,6E,8Z)-11-[tert-butyl(dimethyl)silyl]oxy-5-[tert-butyl(diphenyl)silyl]oxyundeca-6,8-dienoate |
| SMILES | COC(=O)CCC[C@@H](/C=C/C=C\CCO[Si](C)(C)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C34H52O4Si2/c1-33(2,3)39(8,9)37-28-19-11-10-14-21-29(22-20-27-32(35)36-7)38-40(34(4,5)6,30-23-15-12-16-24-30)31-25-17-13-18-26-31/h10-18,21,23-26,29H,19-20,22,27-28H2,1-9H3/b11-10-,21-14+/t29-/m1/s1 |
| InChIKey | FMSGMTSPLGSQDM-WKLYFREDSA-N |
| XLogP | 7.80 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.96 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|