C44H56O4Si2 — CID 15462043
methyl (5S,6E,8Z)-5,11-bis[[tert-butyl(diphenyl)silyl]oxy]undeca-6,8-dienoate (PubChem CID 15462043) has the molecular formula C44H56O4Si2 and a molecular weight of 705.10 g/mol. Its IUPAC name is methyl (5S,6E,8Z)-5,11-bis[[tert-butyl(diphenyl)silyl]oxy]undeca-6,8-dienoate.
| Compound Name | methyl (5S,6E,8Z)-5,11-bis[[tert-butyl(diphenyl)silyl]oxy]undeca-6,8-dienoate |
|---|---|
| PubChem CID | 15462043 |
| Molecular Formula | C44H56O4Si2 |
| Molecular Weight | 705.10 g/mol |
| Exact Mass | 704.37 |
| IUPAC Name | methyl (5S,6E,8Z)-5,11-bis[[tert-butyl(diphenyl)silyl]oxy]undeca-6,8-dienoate |
| SMILES | COC(=O)CCC[C@@H](/C=C/C=C\CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C44H56O4Si2/c1-43(2,3)49(38-27-15-10-16-28-38,39-29-17-11-18-30-39)47-36-23-9-8-14-25-37(26-24-35-42(45)46-7)48-50(44(4,5)6,40-31-19-12-20-32-40)41-33-21-13-22-34-41/h8-22,25,27-34,37H,23-24,26,35-36H2,1-7H3/b9-8-,25-14+/t37-/m1/s1 |
| InChIKey | RAPXQYVBPRSNNA-KODZMSRLSA-N |
| XLogP | 8.35 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 705.10 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|