C28H38O4Si — CID 101068041
methyl (5S,6E,8Z)-5-[tert-butyl(diphenyl)silyl]oxy-11-hydroxyundeca-6,8-dienoate (PubChem CID 101068041) has the molecular formula C28H38O4Si and a molecular weight of 466.69 g/mol. Its IUPAC name is methyl (5S,6E,8Z)-5-[tert-butyl(diphenyl)silyl]oxy-11-hydroxyundeca-6,8-dienoate.
| Compound Name | methyl (5S,6E,8Z)-5-[tert-butyl(diphenyl)silyl]oxy-11-hydroxyundeca-6,8-dienoate |
|---|---|
| PubChem CID | 101068041 |
| Molecular Formula | C28H38O4Si |
| Molecular Weight | 466.69 g/mol |
| Exact Mass | 466.25 |
| IUPAC Name | methyl (5S,6E,8Z)-5-[tert-butyl(diphenyl)silyl]oxy-11-hydroxyundeca-6,8-dienoate |
| SMILES | COC(=O)CCC[C@@H](/C=C/C=C\CCO)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H38O4Si/c1-28(2,3)33(25-18-10-7-11-19-25,26-20-12-8-13-21-26)32-24(16-9-5-6-14-23-29)17-15-22-27(30)31-4/h5-13,16,18-21,24,29H,14-15,17,22-23H2,1-4H3/b6-5-,16-9+/t24-/m1/s1 |
| InChIKey | MRWGBJSOWANSLH-HLGVKDJRSA-N |
| XLogP | 4.77 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.69 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|