C28H41NO4Si — CID 101358762
tert-butyl N-[(Z)-4-[tert-butyl(diphenyl)silyl]oxy-7-hydroxyhept-5-enyl]carbamate (PubChem CID 101358762) has the molecular formula C28H41NO4Si and a molecular weight of 483.73 g/mol. Its IUPAC name is tert-butyl N-[(Z)-4-[tert-butyl(diphenyl)silyl]oxy-7-hydroxyhept-5-enyl]carbamate.
| Compound Name | tert-butyl N-[(Z)-4-[tert-butyl(diphenyl)silyl]oxy-7-hydroxyhept-5-enyl]carbamate |
|---|---|
| PubChem CID | 101358762 |
| Molecular Formula | C28H41NO4Si |
| Molecular Weight | 483.73 g/mol |
| Exact Mass | 483.28 |
| IUPAC Name | tert-butyl N-[(Z)-4-[tert-butyl(diphenyl)silyl]oxy-7-hydroxyhept-5-enyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCC(/C=C\CO)O[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H41NO4Si/c1-27(2,3)32-26(31)29-21-13-15-23(16-14-22-30)33-34(28(4,5)6,24-17-9-7-10-18-24)25-19-11-8-12-20-25/h7-12,14,16-20,23,30H,13,15,21-22H2,1-6H3,(H,29,31)/b16-14- |
| InChIKey | DHYJPXWFNUNXGG-PEZBUJJGSA-N |
| XLogP | 4.78 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.73 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|