C30H45NO5Si — CID 138985529
9-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid (PubChem CID 138985529) has the molecular formula C30H45NO5Si and a molecular weight of 527.78 g/mol. Its IUPAC name is 9-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid.
| Compound Name | 9-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid |
|---|---|
| PubChem CID | 138985529 |
| Molecular Formula | C30H45NO5Si |
| Molecular Weight | 527.78 g/mol |
| Exact Mass | 527.31 |
| IUPAC Name | 9-[tert-butyl(diphenyl)silyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]nonanoic acid |
| SMILES | CC(C)(C)OC(=O)NC(CCCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)O |
| InChI | InChI=1S/C30H45NO5Si/c1-29(2,3)36-28(34)31-26(27(32)33)22-16-8-7-9-17-23-35-37(30(4,5)6,24-18-12-10-13-19-24)25-20-14-11-15-21-25/h10-15,18-21,26H,7-9,16-17,22-23H2,1-6H3,(H,31,34)(H,32,33) |
| InChIKey | ILAHABFZFGBZNM-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.78 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|