C37H61F3O3Si2 — CID 90846905
tert-butyl 8-[tert-butyl(diphenyl)silyl]oxy-2-(2,2-dimethylpropyl)octanoate;trimethyl(trifluoromethyl)silane (PubChem CID 90846905) has the molecular formula C37H61F3O3Si2 and a molecular weight of 667.06 g/mol. Its IUPAC name is tert-butyl 8-[tert-butyl(diphenyl)silyl]oxy-2-(2,2-dimethylpropyl)octanoate;trimethyl(trifluoromethyl)silane.
| Compound Name | tert-butyl 8-[tert-butyl(diphenyl)silyl]oxy-2-(2,2-dimethylpropyl)octanoate;trimethyl(trifluoromethyl)silane |
|---|---|
| PubChem CID | 90846905 |
| Molecular Formula | C37H61F3O3Si2 |
| Molecular Weight | 667.06 g/mol |
| Exact Mass | 666.41 |
| IUPAC Name | tert-butyl 8-[tert-butyl(diphenyl)silyl]oxy-2-(2,2-dimethylpropyl)octanoate;trimethyl(trifluoromethyl)silane |
| SMILES | CC(C)(C)CC(CCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OC(C)(C)C.C[Si](C)(C)C(F)(F)F |
| InChI | InChI=1S/C33H52O3Si.C4H9F3Si/c1-31(2,3)26-27(30(34)36-32(4,5)6)20-14-10-11-19-25-35-37(33(7,8)9,28-21-15-12-16-22-28)29-23-17-13-18-24-29;1-8(2,3)4(5,6)7/h12-13,15-18,21-24,27H,10-11,14,19-20,25-26H2,1-9H3;1-3H3 |
| InChIKey | APCWMJDQULDAEK-UHFFFAOYSA-N |
| XLogP | 10.33 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.06 |
| LogP ≤ 5 | 10.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|