C36H48O5Si — CID 166561326
3-O-benzyl 1-O-tert-butyl 2-[6-[tert-butyl(diphenyl)silyl]oxyhexyl]propanedioate (PubChem CID 166561326) has the molecular formula C36H48O5Si and a molecular weight of 588.86 g/mol. Its IUPAC name is 3-O-benzyl 1-O-tert-butyl 2-[6-[tert-butyl(diphenyl)silyl]oxyhexyl]propanedioate.
| Compound Name | 3-O-benzyl 1-O-tert-butyl 2-[6-[tert-butyl(diphenyl)silyl]oxyhexyl]propanedioate |
|---|---|
| PubChem CID | 166561326 |
| Molecular Formula | C36H48O5Si |
| Molecular Weight | 588.86 g/mol |
| Exact Mass | 588.33 |
| IUPAC Name | 3-O-benzyl 1-O-tert-butyl 2-[6-[tert-butyl(diphenyl)silyl]oxyhexyl]propanedioate |
| SMILES | CC(C)(C)OC(=O)C(CCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C36H48O5Si/c1-35(2,3)41-34(38)32(33(37)39-28-29-20-12-9-13-21-29)26-18-7-8-19-27-40-42(36(4,5)6,30-22-14-10-15-23-30)31-24-16-11-17-25-31/h9-17,20-25,32H,7-8,18-19,26-28H2,1-6H3 |
| InChIKey | BYTVRJZDHGQWMC-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.86 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|