C34H53F3O5Si2 — CID 91123549
9-[tert-butyl(diphenyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonyl]nonanoic acid;trimethyl(trifluoromethyl)silane (PubChem CID 91123549) has the molecular formula C34H53F3O5Si2 and a molecular weight of 654.96 g/mol. Its IUPAC name is 9-[tert-butyl(diphenyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonyl]nonanoic acid;trimethyl(trifluoromethyl)silane.
| Compound Name | 9-[tert-butyl(diphenyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonyl]nonanoic acid;trimethyl(trifluoromethyl)silane |
|---|---|
| PubChem CID | 91123549 |
| Molecular Formula | C34H53F3O5Si2 |
| Molecular Weight | 654.96 g/mol |
| Exact Mass | 654.34 |
| IUPAC Name | 9-[tert-butyl(diphenyl)silyl]oxy-3-[(2-methylpropan-2-yl)oxycarbonyl]nonanoic acid;trimethyl(trifluoromethyl)silane |
| SMILES | CC(C)(C)OC(=O)C(CCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)CC(=O)O.C[Si](C)(C)C(F)(F)F |
| InChI | InChI=1S/C30H44O5Si.C4H9F3Si/c1-29(2,3)35-28(33)24(23-27(31)32)17-11-7-8-16-22-34-36(30(4,5)6,25-18-12-9-13-19-25)26-20-14-10-15-21-26;1-8(2,3)4(5,6)7/h9-10,12-15,18-21,24H,7-8,11,16-17,22-23H2,1-6H3,(H,31,32);1-3H3 |
| InChIKey | YFPOTQCCHJLFDK-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.96 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|