C28H40O5Si — CID 101042951
tert-butyl 3-[(2R,3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]-3-hydroxypropanoate (PubChem CID 101042951) has the molecular formula C28H40O5Si and a molecular weight of 484.71 g/mol. Its IUPAC name is tert-butyl 3-[(2R,3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]-3-hydroxypropanoate.
| Compound Name | tert-butyl 3-[(2R,3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 101042951 |
| Molecular Formula | C28H40O5Si |
| Molecular Weight | 484.71 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | tert-butyl 3-[(2R,3R)-3-[3-[tert-butyl(diphenyl)silyl]oxypropyl]oxiran-2-yl]-3-hydroxypropanoate |
| SMILES | CC(C)(C)OC(=O)CC(O)[C@H]1O[C@@H]1CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H40O5Si/c1-27(2,3)33-25(30)20-23(29)26-24(32-26)18-13-19-31-34(28(4,5)6,21-14-9-7-10-15-21)22-16-11-8-12-17-22/h7-12,14-17,23-24,26,29H,13,18-20H2,1-6H3/t23?,24-,26-/m1/s1 |
| InChIKey | XOPKHIZJEWHZQC-VDNTZQRCSA-N |
| XLogP | 4.20 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.71 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|