C32H50O5Si2 — CID 10918838
tert-butyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]propanoate (PubChem CID 10918838) has the molecular formula C32H50O5Si2 and a molecular weight of 570.92 g/mol. Its IUPAC name is tert-butyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]propanoate.
| Compound Name | tert-butyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]propanoate |
|---|---|
| PubChem CID | 10918838 |
| Molecular Formula | C32H50O5Si2 |
| Molecular Weight | 570.92 g/mol |
| Exact Mass | 570.32 |
| IUPAC Name | tert-butyl (3S)-3-[tert-butyl(dimethyl)silyl]oxy-3-[(2R,3R)-3-[[tert-butyl(diphenyl)silyl]oxymethyl]oxiran-2-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)C[C@H](O[Si](C)(C)C(C)(C)C)[C@@H]1O[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C32H50O5Si2/c1-30(2,3)36-28(33)22-26(37-38(10,11)31(4,5)6)29-27(35-29)23-34-39(32(7,8)9,24-18-14-12-15-19-24)25-20-16-13-17-21-25/h12-21,26-27,29H,22-23H2,1-11H3/t26-,27+,29-/m0/s1 |
| InChIKey | HZNPLCYJRFGDOV-GKRYNVPLSA-N |
| XLogP | 6.45 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.92 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|