C29H42O3Si — CID 166524601
tert-butyl 5-[(1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]pentanoate (PubChem CID 166524601) has the molecular formula C29H42O3Si and a molecular weight of 466.74 g/mol. Its IUPAC name is tert-butyl 5-[(1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]pentanoate.
| Compound Name | tert-butyl 5-[(1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]pentanoate |
|---|---|
| PubChem CID | 166524601 |
| Molecular Formula | C29H42O3Si |
| Molecular Weight | 466.74 g/mol |
| Exact Mass | 466.29 |
| IUPAC Name | tert-butyl 5-[(1S,2S)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]pentanoate |
| SMILES | CC(C)(C)OC(=O)CCCC[C@H]1C[C@@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C29H42O3Si/c1-28(2,3)32-27(30)20-14-13-15-23-21-24(23)22-31-33(29(4,5)6,25-16-9-7-10-17-25)26-18-11-8-12-19-26/h7-12,16-19,23-24H,13-15,20-22H2,1-6H3/t23-,24+/m0/s1 |
| InChIKey | AGPVFADTUDCUAX-BJKOFHAPSA-N |
| XLogP | 6.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.74 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|