C30H44O3Si — CID 166525128
tert-butyl 5-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-2-methylpentanoate (PubChem CID 166525128) has the molecular formula C30H44O3Si and a molecular weight of 480.77 g/mol. Its IUPAC name is tert-butyl 5-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-2-methylpentanoate.
| Compound Name | tert-butyl 5-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-2-methylpentanoate |
|---|---|
| PubChem CID | 166525128 |
| Molecular Formula | C30H44O3Si |
| Molecular Weight | 480.77 g/mol |
| Exact Mass | 480.31 |
| IUPAC Name | tert-butyl 5-[(1R,2R)-2-[[tert-butyl(diphenyl)silyl]oxymethyl]cyclopropyl]-2-methylpentanoate |
| SMILES | CC(CCC[C@@H]1C[C@H]1CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C30H44O3Si/c1-23(28(31)33-29(2,3)4)15-14-16-24-21-25(24)22-32-34(30(5,6)7,26-17-10-8-11-18-26)27-19-12-9-13-20-27/h8-13,17-20,23-25H,14-16,21-22H2,1-7H3/t23?,24-,25+/m1/s1 |
| InChIKey | UUPUMPYDYFSYJH-ZQWZXOJDSA-N |
| XLogP | 6.35 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.77 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|