C27H42N2O3Si — CID 59734160
tert-butyl N-[6-[tert-butyl(diphenyl)silyl]oxyhexan-2-ylamino]carbamate (PubChem CID 59734160) has the molecular formula C27H42N2O3Si and a molecular weight of 470.73 g/mol. Its IUPAC name is tert-butyl N-[6-[tert-butyl(diphenyl)silyl]oxyhexan-2-ylamino]carbamate.
| Compound Name | tert-butyl N-[6-[tert-butyl(diphenyl)silyl]oxyhexan-2-ylamino]carbamate |
|---|---|
| PubChem CID | 59734160 |
| Molecular Formula | C27H42N2O3Si |
| Molecular Weight | 470.73 g/mol |
| Exact Mass | 470.30 |
| IUPAC Name | tert-butyl N-[6-[tert-butyl(diphenyl)silyl]oxyhexan-2-ylamino]carbamate |
| SMILES | CC(CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H42N2O3Si/c1-22(28-29-25(30)32-26(2,3)4)16-14-15-21-31-33(27(5,6)7,23-17-10-8-11-18-23)24-19-12-9-13-20-24/h8-13,17-20,22,28H,14-16,21H2,1-7H3,(H,29,30) |
| InChIKey | CBPQJCLOZHHIHJ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.73 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|