C38H49NO5Si — CID 46848457
[10-[tert-butyl(diphenyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]dec-6-yn-5-yl] benzoate (PubChem CID 46848457) has the molecular formula C38H49NO5Si and a molecular weight of 627.90 g/mol. Its IUPAC name is [10-[tert-butyl(diphenyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]dec-6-yn-5-yl] benzoate.
| Compound Name | [10-[tert-butyl(diphenyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]dec-6-yn-5-yl] benzoate |
|---|---|
| PubChem CID | 46848457 |
| Molecular Formula | C38H49NO5Si |
| Molecular Weight | 627.90 g/mol |
| Exact Mass | 627.34 |
| IUPAC Name | [10-[tert-butyl(diphenyl)silyl]oxy-1-[(2-methylpropan-2-yl)oxycarbonylamino]dec-6-yn-5-yl] benzoate |
| SMILES | CC(C)(C)OC(=O)NCCCCC(C#CCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C38H49NO5Si/c1-37(2,3)44-36(41)39-29-19-18-24-32(43-35(40)31-21-11-7-12-22-31)23-13-10-20-30-42-45(38(4,5)6,33-25-14-8-15-26-33)34-27-16-9-17-28-34/h7-9,11-12,14-17,21-22,25-28,32H,10,18-20,24,29-30H2,1-6H3,(H,39,41) |
| InChIKey | SRCXOCOKIASUPA-UHFFFAOYSA-N |
| XLogP | 7.27 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.90 |
| LogP ≤ 5 | 7.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|