C44H52Br2O6Si — CID 159916435
[(4R)-2-bromo-7-[tert-butyl(diphenyl)silyl]oxyhept-1-en-4-yl] benzoate;[(4R)-2-bromo-7-hydroxyhept-1-en-4-yl] benzoate (PubChem CID 159916435) has the molecular formula C44H52Br2O6Si and a molecular weight of 864.79 g/mol. Its IUPAC name is [(4R)-2-bromo-7-[tert-butyl(diphenyl)silyl]oxyhept-1-en-4-yl] benzoate;[(4R)-2-bromo-7-hydroxyhept-1-en-4-yl] benzoate.
| Compound Name | [(4R)-2-bromo-7-[tert-butyl(diphenyl)silyl]oxyhept-1-en-4-yl] benzoate;[(4R)-2-bromo-7-hydroxyhept-1-en-4-yl] benzoate |
|---|---|
| PubChem CID | 159916435 |
| Molecular Formula | C44H52Br2O6Si |
| Molecular Weight | 864.79 g/mol |
| Exact Mass | 862.19 |
| IUPAC Name | [(4R)-2-bromo-7-[tert-butyl(diphenyl)silyl]oxyhept-1-en-4-yl] benzoate;[(4R)-2-bromo-7-hydroxyhept-1-en-4-yl] benzoate |
| SMILES | C=C(Br)C[C@@H](CCCO)OC(=O)c1ccccc1.C=C(Br)C[C@@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)c1ccccc1 |
| InChI | InChI=1S/C30H35BrO3Si.C14H17BrO3/c1-24(31)23-26(34-29(32)25-15-8-5-9-16-25)17-14-22-33-35(30(2,3)4,27-18-10-6-11-19-27)28-20-12-7-13-21-28;1-11(15)10-13(8-5-9-16)18-14(17)12-6-3-2-4-7-12/h5-13,15-16,18-21,26H,1,14,17,22-23H2,2-4H3;2-4,6-7,13,16H,1,5,8-10H2/t26-;13-/m11/s1 |
| InChIKey | NXVMWQOAHHSOAU-CRPMBFEOSA-N |
| XLogP | 10.15 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 864.79 |
| LogP ≤ 5 | 10.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|