C37H53BrO3Si2 — CID 71492902
[(4S,5S)-7-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyoct-7-enoxy]-tert-butyl-diphenylsilane (PubChem CID 71492902) has the molecular formula C37H53BrO3Si2 and a molecular weight of 681.90 g/mol. Its IUPAC name is [(4S,5S)-7-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyoct-7-enoxy]-tert-butyl-diphenylsilane.
| Compound Name | [(4S,5S)-7-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyoct-7-enoxy]-tert-butyl-diphenylsilane |
|---|---|
| PubChem CID | 71492902 |
| Molecular Formula | C37H53BrO3Si2 |
| Molecular Weight | 681.90 g/mol |
| Exact Mass | 680.27 |
| IUPAC Name | [(4S,5S)-7-bromo-5-[tert-butyl(dimethyl)silyl]oxy-4-phenylmethoxyoct-7-enoxy]-tert-butyl-diphenylsilane |
| SMILES | C=C(Br)C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OCc1ccccc1 |
| InChI | InChI=1S/C37H53BrO3Si2/c1-30(38)28-35(41-42(8,9)36(2,3)4)34(39-29-31-20-13-10-14-21-31)26-19-27-40-43(37(5,6)7,32-22-15-11-16-23-32)33-24-17-12-18-25-33/h10-18,20-25,34-35H,1,19,26-29H2,2-9H3/t34-,35-/m0/s1 |
| InChIKey | LJWMOCOBJRSCFL-PXLJZGITSA-N |
| XLogP | 9.62 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.90 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|