C28H36O2Si — CID 11546522
(3S)-6-[tert-butyl(diphenyl)silyl]oxy-1-phenylhexan-3-ol (PubChem CID 11546522) has the molecular formula C28H36O2Si and a molecular weight of 432.68 g/mol. Its IUPAC name is (3S)-6-[tert-butyl(diphenyl)silyl]oxy-1-phenylhexan-3-ol.
| Compound Name | (3S)-6-[tert-butyl(diphenyl)silyl]oxy-1-phenylhexan-3-ol |
|---|---|
| PubChem CID | 11546522 |
| Molecular Formula | C28H36O2Si |
| Molecular Weight | 432.68 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | (3S)-6-[tert-butyl(diphenyl)silyl]oxy-1-phenylhexan-3-ol |
| SMILES | CC(C)(C)[Si](OCCC[C@@H](O)CCc1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H36O2Si/c1-28(2,3)31(26-17-9-5-10-18-26,27-19-11-6-12-20-27)30-23-13-16-25(29)22-21-24-14-7-4-8-15-24/h4-12,14-15,17-20,25,29H,13,16,21-23H2,1-3H3/t25-/m1/s1 |
| InChIKey | SJISRBUNAJQIJC-RUZDIDTESA-N |
| XLogP | 5.34 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|