C24H36O3Si — CID 102323148
(2S,4S)-7-[tert-butyl(diphenyl)silyl]oxy-2-methylheptane-1,4-diol (PubChem CID 102323148) has the molecular formula C24H36O3Si and a molecular weight of 400.64 g/mol. Its IUPAC name is (2S,4S)-7-[tert-butyl(diphenyl)silyl]oxy-2-methylheptane-1,4-diol.
| Compound Name | (2S,4S)-7-[tert-butyl(diphenyl)silyl]oxy-2-methylheptane-1,4-diol |
|---|---|
| PubChem CID | 102323148 |
| Molecular Formula | C24H36O3Si |
| Molecular Weight | 400.64 g/mol |
| Exact Mass | 400.24 |
| IUPAC Name | (2S,4S)-7-[tert-butyl(diphenyl)silyl]oxy-2-methylheptane-1,4-diol |
| SMILES | C[C@H](CO)C[C@@H](O)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C24H36O3Si/c1-20(19-25)18-21(26)12-11-17-27-28(24(2,3)4,22-13-7-5-8-14-22)23-15-9-6-10-16-23/h5-10,13-16,20-21,25-26H,11-12,17-19H2,1-4H3/t20-,21-/m0/s1 |
| InChIKey | LDFKNUODNOFCRL-SFTDATJTSA-N |
| XLogP | 3.72 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.64 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|