C25H36OSi — CID 160977016
tert-butyl-[(4S)-4,6-dimethylhept-6-enoxy]-diphenylsilane (PubChem CID 160977016) has the molecular formula C25H36OSi and a molecular weight of 380.65 g/mol. Its IUPAC name is tert-butyl-[(4S)-4,6-dimethylhept-6-enoxy]-diphenylsilane.
| Compound Name | tert-butyl-[(4S)-4,6-dimethylhept-6-enoxy]-diphenylsilane |
|---|---|
| PubChem CID | 160977016 |
| Molecular Formula | C25H36OSi |
| Molecular Weight | 380.65 g/mol |
| Exact Mass | 380.25 |
| IUPAC Name | tert-butyl-[(4S)-4,6-dimethylhept-6-enoxy]-diphenylsilane |
| SMILES | C=C(C)C[C@@H](C)CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H36OSi/c1-21(2)20-22(3)14-13-19-26-27(25(4,5)6,23-15-9-7-10-16-23)24-17-11-8-12-18-24/h7-12,15-18,22H,1,13-14,19-20H2,2-6H3/t22-/m0/s1 |
| InChIKey | TZYKFGIRCWFGHP-QFIPXVFZSA-N |
| XLogP | 5.95 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.65 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|