C26H34O4Si — CID 58842048
prop-2-enyl 2-acetyl-5-[tert-butyl(diphenyl)silyl]oxypentanoate (PubChem CID 58842048) has the molecular formula C26H34O4Si and a molecular weight of 438.64 g/mol. Its IUPAC name is prop-2-enyl 2-acetyl-5-[tert-butyl(diphenyl)silyl]oxypentanoate.
| Compound Name | prop-2-enyl 2-acetyl-5-[tert-butyl(diphenyl)silyl]oxypentanoate |
|---|---|
| PubChem CID | 58842048 |
| Molecular Formula | C26H34O4Si |
| Molecular Weight | 438.64 g/mol |
| Exact Mass | 438.22 |
| IUPAC Name | prop-2-enyl 2-acetyl-5-[tert-butyl(diphenyl)silyl]oxypentanoate |
| SMILES | C=CCOC(=O)C(CCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)C(C)=O |
| InChI | InChI=1S/C26H34O4Si/c1-6-19-29-25(28)24(21(2)27)18-13-20-30-31(26(3,4)5,22-14-9-7-10-15-22)23-16-11-8-12-17-23/h6-12,14-17,24H,1,13,18-20H2,2-5H3 |
| InChIKey | DKMKTNHQHJEIQK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.64 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|