C25H34O3Si — CID 172860642
5-[tert-butyl(diphenyl)silyl]oxypentyl 2-methylprop-2-enoate (PubChem CID 172860642) has the molecular formula C25H34O3Si and a molecular weight of 410.63 g/mol. Its IUPAC name is 5-[tert-butyl(diphenyl)silyl]oxypentyl 2-methylprop-2-enoate.
| Compound Name | 5-[tert-butyl(diphenyl)silyl]oxypentyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 172860642 |
| Molecular Formula | C25H34O3Si |
| Molecular Weight | 410.63 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | 5-[tert-butyl(diphenyl)silyl]oxypentyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C25H34O3Si/c1-21(2)24(26)27-19-13-8-14-20-28-29(25(3,4)5,22-15-9-6-10-16-22)23-17-11-7-12-18-23/h6-7,9-12,15-18H,1,8,13-14,19-20H2,2-5H3 |
| InChIKey | ZHMWCNZNRSUCNF-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.63 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|