C21H34O4Si — CID 19012652
3-[dibutoxy(phenyl)silyl]propyl 2-methylprop-2-enoate (PubChem CID 19012652) has the molecular formula C21H34O4Si and a molecular weight of 378.59 g/mol. Its IUPAC name is 3-[dibutoxy(phenyl)silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[dibutoxy(phenyl)silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 19012652 |
| Molecular Formula | C21H34O4Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | 3-[dibutoxy(phenyl)silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](OCCCC)(OCCCC)c1ccccc1 |
| InChI | InChI=1S/C21H34O4Si/c1-5-7-16-24-26(25-17-8-6-2,20-13-10-9-11-14-20)18-12-15-23-21(22)19(3)4/h9-11,13-14H,3,5-8,12,15-18H2,1-2,4H3 |
| InChIKey | ZQQPAHKRIGASOL-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|