C17H26O5Si — CID 139977935
3-[diethoxy(phenoxy)silyl]propyl 2-methylprop-2-enoate (PubChem CID 139977935) has the molecular formula C17H26O5Si and a molecular weight of 338.48 g/mol. Its IUPAC name is 3-[diethoxy(phenoxy)silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[diethoxy(phenoxy)silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139977935 |
| Molecular Formula | C17H26O5Si |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 3-[diethoxy(phenoxy)silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](OCC)(OCC)Oc1ccccc1 |
| InChI | InChI=1S/C17H26O5Si/c1-5-20-23(21-6-2,22-16-11-8-7-9-12-16)14-10-13-19-17(18)15(3)4/h7-9,11-12H,3,5-6,10,13-14H2,1-2,4H3 |
| InChIKey | SAVVGIXKACELQE-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|