C20H44O8Si2 — CID 87080022
3-[diethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;tetraethyl silicate (PubChem CID 87080022) has the molecular formula C20H44O8Si2 and a molecular weight of 468.74 g/mol. Its IUPAC name is 3-[diethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;tetraethyl silicate.
| Compound Name | 3-[diethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;tetraethyl silicate |
|---|---|
| PubChem CID | 87080022 |
| Molecular Formula | C20H44O8Si2 |
| Molecular Weight | 468.74 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | 3-[diethoxy(methyl)silyl]propyl 2-methylprop-2-enoate;tetraethyl silicate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(OCC)OCC.CCO[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C12H24O4Si.C8H20O4Si/c1-6-15-17(5,16-7-2)10-8-9-14-12(13)11(3)4;1-5-9-13(10-6-2,11-7-3)12-8-4/h3,6-10H2,1-2,4-5H3;5-8H2,1-4H3 |
| InChIKey | KUBMTPHQBXMHIW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.74 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|