C15H28O2Si — CID 167321908
3-[diethyl(2-methylprop-2-enyl)silyl]propyl 2-methylprop-2-enoate (PubChem CID 167321908) has the molecular formula C15H28O2Si and a molecular weight of 268.47 g/mol. Its IUPAC name is 3-[diethyl(2-methylprop-2-enyl)silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[diethyl(2-methylprop-2-enyl)silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 167321908 |
| Molecular Formula | C15H28O2Si |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.19 |
| IUPAC Name | 3-[diethyl(2-methylprop-2-enyl)silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C[Si](CC)(CC)CCCOC(=O)C(=C)C |
| InChI | InChI=1S/C15H28O2Si/c1-7-18(8-2,12-13(3)4)11-9-10-17-15(16)14(5)6/h3,5,7-12H2,1-2,4,6H3 |
| InChIKey | PRSPPDRDLMMVDH-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|