C24H36O5Si3 — CID 66675453
3-[bis[[dimethyl(phenyl)silyl]oxy]-methoxysilyl]propyl 2-methylprop-2-enoate (PubChem CID 66675453) has the molecular formula C24H36O5Si3 and a molecular weight of 488.81 g/mol. Its IUPAC name is 3-[bis[[dimethyl(phenyl)silyl]oxy]-methoxysilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[bis[[dimethyl(phenyl)silyl]oxy]-methoxysilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 66675453 |
| Molecular Formula | C24H36O5Si3 |
| Molecular Weight | 488.81 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 3-[bis[[dimethyl(phenyl)silyl]oxy]-methoxysilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](OC)(O[Si](C)(C)c1ccccc1)O[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C24H36O5Si3/c1-21(2)24(25)27-19-14-20-32(26-3,28-30(4,5)22-15-10-8-11-16-22)29-31(6,7)23-17-12-9-13-18-23/h8-13,15-18H,1,14,19-20H2,2-7H3 |
| InChIKey | XDUOJNFUTGDKFX-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.81 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|