C22H30O3Si2 — CID 54512859
3-[dimethyl-[methyl(diphenyl)silyl]oxysilyl]propyl 2-methylprop-2-enoate (PubChem CID 54512859) has the molecular formula C22H30O3Si2 and a molecular weight of 398.65 g/mol. Its IUPAC name is 3-[dimethyl-[methyl(diphenyl)silyl]oxysilyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[dimethyl-[methyl(diphenyl)silyl]oxysilyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 54512859 |
| Molecular Formula | C22H30O3Si2 |
| Molecular Weight | 398.65 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | 3-[dimethyl-[methyl(diphenyl)silyl]oxysilyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](C)(C)O[Si](C)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H30O3Si2/c1-19(2)22(23)24-17-12-18-26(3,4)25-27(5,20-13-8-6-9-14-20)21-15-10-7-11-16-21/h6-11,13-16H,1,12,17-18H2,2-5H3 |
| InChIKey | YKJBKLUNUHCGIW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.65 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|