C19H30O6Si — CID 174809447
(2-ethenylphenyl)methanol;3-trimethoxysilylpropyl 2-methylprop-2-enoate (PubChem CID 174809447) has the molecular formula C19H30O6Si and a molecular weight of 382.53 g/mol. Its IUPAC name is (2-ethenylphenyl)methanol;3-trimethoxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | (2-ethenylphenyl)methanol;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 174809447 |
| Molecular Formula | C19H30O6Si |
| Molecular Weight | 382.53 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | (2-ethenylphenyl)methanol;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](OC)(OC)OC.C=Cc1ccccc1CO |
| InChI | InChI=1S/C10H20O5Si.C9H10O/c1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5;1-2-8-5-3-4-6-9(8)7-10/h1,6-8H2,2-5H3;2-6,10H,1,7H2 |
| InChIKey | IQQUXLBRMOLIBA-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.53 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|