C16H32O7Si2 — CID 174967199
3-silylpropyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl prop-2-enoate (PubChem CID 174967199) has the molecular formula C16H32O7Si2 and a molecular weight of 392.60 g/mol. Its IUPAC name is 3-silylpropyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl prop-2-enoate.
| Compound Name | 3-silylpropyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl prop-2-enoate |
|---|---|
| PubChem CID | 174967199 |
| Molecular Formula | C16H32O7Si2 |
| Molecular Weight | 392.60 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3-silylpropyl 2-methylprop-2-enoate;3-trimethoxysilylpropyl prop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[SiH3].C=CC(=O)OCCC[Si](OC)(OC)OC |
| InChI | InChI=1S/C9H18O5Si.C7H14O2Si/c1-5-9(10)14-7-6-8-15(11-2,12-3)13-4;1-6(2)7(8)9-4-3-5-10/h5H,1,6-8H2,2-4H3;1,3-5H2,2,10H3 |
| InChIKey | ZEVXITRSKTUOAF-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.60 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|