C13H23NO6Si — CID 139788654
3-[dimethoxy-[(prop-2-enoylamino)methoxy]silyl]propyl 2-methylprop-2-enoate (PubChem CID 139788654) has the molecular formula C13H23NO6Si and a molecular weight of 317.41 g/mol. Its IUPAC name is 3-[dimethoxy-[(prop-2-enoylamino)methoxy]silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[dimethoxy-[(prop-2-enoylamino)methoxy]silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139788654 |
| Molecular Formula | C13H23NO6Si |
| Molecular Weight | 317.41 g/mol |
| Exact Mass | 317.13 |
| IUPAC Name | 3-[dimethoxy-[(prop-2-enoylamino)methoxy]silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=CC(=O)NCO[Si](CCCOC(=O)C(=C)C)(OC)OC |
| InChI | InChI=1S/C13H23NO6Si/c1-6-12(15)14-10-20-21(17-4,18-5)9-7-8-19-13(16)11(2)3/h6H,1-2,7-10H2,3-5H3,(H,14,15) |
| InChIKey | CAZBUIDHPWVMLX-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.41 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|