C13H24O6Si — CID 175429463
3-[dimethoxy-[2-(oxiran-2-yl)ethoxy]silyl]propyl 2-methylprop-2-enoate (PubChem CID 175429463) has the molecular formula C13H24O6Si and a molecular weight of 304.42 g/mol. Its IUPAC name is 3-[dimethoxy-[2-(oxiran-2-yl)ethoxy]silyl]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[dimethoxy-[2-(oxiran-2-yl)ethoxy]silyl]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175429463 |
| Molecular Formula | C13H24O6Si |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 3-[dimethoxy-[2-(oxiran-2-yl)ethoxy]silyl]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](OC)(OC)OCCC1CO1 |
| InChI | InChI=1S/C13H24O6Si/c1-11(2)13(14)17-7-5-9-20(15-3,16-4)19-8-6-12-10-18-12/h12H,1,5-10H2,2-4H3 |
| InChIKey | IWBNDAHPDLTVNE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 66.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|