C22H40O9Si — CID 154119799
4-[1,1-diethoxyethoxy-methoxy-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxybutyl 2-methylprop-2-enoate (PubChem CID 154119799) has the molecular formula C22H40O9Si and a molecular weight of 476.64 g/mol. Its IUPAC name is 4-[1,1-diethoxyethoxy-methoxy-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxybutyl 2-methylprop-2-enoate.
| Compound Name | 4-[1,1-diethoxyethoxy-methoxy-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxybutyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 154119799 |
| Molecular Formula | C22H40O9Si |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | 4-[1,1-diethoxyethoxy-methoxy-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxybutyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCO[Si](CCCOC(=O)C(=C)C)(OC)OC(C)(OCC)OCC |
| InChI | InChI=1S/C22H40O9Si/c1-9-28-22(7,29-10-2)31-32(25-8,17-13-15-27-21(24)19(5)6)30-16-12-11-14-26-20(23)18(3)4/h3,5,9-17H2,1-2,4,6-8H3 |
| InChIKey | OGAFVEPGGSERTK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|