C21H42O6Si — CID 139816449
2-(3-tributoxysilylpropoxy)ethyl 2-methylprop-2-enoate (PubChem CID 139816449) has the molecular formula C21H42O6Si and a molecular weight of 418.65 g/mol. Its IUPAC name is 2-(3-tributoxysilylpropoxy)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(3-tributoxysilylpropoxy)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 139816449 |
| Molecular Formula | C21H42O6Si |
| Molecular Weight | 418.65 g/mol |
| Exact Mass | 418.28 |
| IUPAC Name | 2-(3-tributoxysilylpropoxy)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCC[Si](OCCCC)(OCCCC)OCCCC |
| InChI | InChI=1S/C21H42O6Si/c1-6-9-14-25-28(26-15-10-7-2,27-16-11-8-3)19-12-13-23-17-18-24-21(22)20(4)5/h4,6-19H2,1-3,5H3 |
| InChIKey | DDSZEPXADURSHS-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.65 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|