C29H58O4Si — CID 123411078
2-[2-(3-trihexylsilylpropoxy)ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 123411078) has the molecular formula C29H58O4Si and a molecular weight of 498.87 g/mol. Its IUPAC name is 2-[2-(3-trihexylsilylpropoxy)ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(3-trihexylsilylpropoxy)ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 123411078 |
| Molecular Formula | C29H58O4Si |
| Molecular Weight | 498.87 g/mol |
| Exact Mass | 498.41 |
| IUPAC Name | 2-[2-(3-trihexylsilylpropoxy)ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCOCCC[Si](CCCCCC)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C29H58O4Si/c1-6-9-12-15-24-34(25-16-13-10-7-2,26-17-14-11-8-3)27-18-19-31-20-21-32-22-23-33-29(30)28(4)5/h4,6-27H2,1-3,5H3 |
| InChIKey | FZVVXKUNJYULCQ-UHFFFAOYSA-N |
| XLogP | 8.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.87 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|