C18H35NO8Si — CID 152545568
2-[2-(3-triethoxysilylpropoxycarbonylamino)ethoxy]ethyl 2-methylprop-2-enoate (PubChem CID 152545568) has the molecular formula C18H35NO8Si and a molecular weight of 421.56 g/mol. Its IUPAC name is 2-[2-(3-triethoxysilylpropoxycarbonylamino)ethoxy]ethyl 2-methylprop-2-enoate.
| Compound Name | 2-[2-(3-triethoxysilylpropoxycarbonylamino)ethoxy]ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 152545568 |
| Molecular Formula | C18H35NO8Si |
| Molecular Weight | 421.56 g/mol |
| Exact Mass | 421.21 |
| IUPAC Name | 2-[2-(3-triethoxysilylpropoxycarbonylamino)ethoxy]ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCOCCNC(=O)OCCC[Si](OCC)(OCC)OCC |
| InChI | InChI=1S/C18H35NO8Si/c1-6-25-28(26-7-2,27-8-3)15-9-11-24-18(21)19-10-12-22-13-14-23-17(20)16(4)5/h4,6-15H2,1-3,5H3,(H,19,21) |
| InChIKey | YMKLBFUUDOSYFD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 101.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.56 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|