C22H43NO8Si — CID 175518240
2-methyl-5-[2-(7-triethoxysilylheptoxycarbonylamino)ethoxy]pent-2-enoic acid (PubChem CID 175518240) has the molecular formula C22H43NO8Si and a molecular weight of 477.67 g/mol. Its IUPAC name is 2-methyl-5-[2-(7-triethoxysilylheptoxycarbonylamino)ethoxy]pent-2-enoic acid.
| Compound Name | 2-methyl-5-[2-(7-triethoxysilylheptoxycarbonylamino)ethoxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 175518240 |
| Molecular Formula | C22H43NO8Si |
| Molecular Weight | 477.67 g/mol |
| Exact Mass | 477.28 |
| IUPAC Name | 2-methyl-5-[2-(7-triethoxysilylheptoxycarbonylamino)ethoxy]pent-2-enoic acid |
| SMILES | CCO[Si](CCCCCCCOC(=O)NCCOCCC=C(C)C(=O)O)(OCC)OCC |
| InChI | InChI=1S/C22H43NO8Si/c1-5-29-32(30-6-2,31-7-3)19-12-10-8-9-11-17-28-22(26)23-15-18-27-16-13-14-20(4)21(24)25/h14H,5-13,15-19H2,1-4H3,(H,23,26)(H,24,25) |
| InChIKey | RIXSVEMBOCENCW-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 112.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.67 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|