C18H39NO9Si — CID 102138334
2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl N-(3-triethoxysilylpropyl)carbamate (PubChem CID 102138334) has the molecular formula C18H39NO9Si and a molecular weight of 441.59 g/mol. Its IUPAC name is 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 102138334 |
| Molecular Formula | C18H39NO9Si |
| Molecular Weight | 441.59 g/mol |
| Exact Mass | 441.24 |
| IUPAC Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCCOCCOCCOCCO)(OCC)OCC |
| InChI | InChI=1S/C18H39NO9Si/c1-4-26-29(27-5-2,28-6-3)17-7-8-19-18(21)25-16-15-24-14-13-23-12-11-22-10-9-20/h20H,4-17H2,1-3H3,(H,19,21) |
| InChIKey | MTZTYGXIBREGSH-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.59 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|