C19H44NO7Si3 — CID 166047507
CID 166047507 (PubChem CID 166047507) has the molecular formula C19H44NO7Si3 and a molecular weight of 482.82 g/mol.
| Compound Name | CID 166047507 |
|---|---|
| PubChem CID | 166047507 |
| Molecular Formula | C19H44NO7Si3 |
| Molecular Weight | 482.82 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | — |
| SMILES | CCO[Si](CCCNC(=O)OCCOCCC[Si](C)O[Si](C)(C)C)(OCC)OCC |
| InChI | InChI=1S/C19H44NO7Si3/c1-8-24-30(25-9-2,26-10-3)18-11-13-20-19(21)23-16-15-22-14-12-17-28(4)27-29(5,6)7/h8-18H2,1-7H3,(H,20,21) |
| InChIKey | JQBRPGIWBOIRGD-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.82 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|