C17H36N2O6Si — CID 59582714
[3-(butan-2-ylamino)-3-oxopropyl] N-(3-triethoxysilylpropyl)carbamate (PubChem CID 59582714) has the molecular formula C17H36N2O6Si and a molecular weight of 392.57 g/mol. Its IUPAC name is [3-(butan-2-ylamino)-3-oxopropyl] N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | [3-(butan-2-ylamino)-3-oxopropyl] N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 59582714 |
| Molecular Formula | C17H36N2O6Si |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | [3-(butan-2-ylamino)-3-oxopropyl] N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCCC(=O)NC(C)CC)(OCC)OCC |
| InChI | InChI=1S/C17H36N2O6Si/c1-6-15(5)19-16(20)11-13-22-17(21)18-12-10-14-26(23-7-2,24-8-3)25-9-4/h15H,6-14H2,1-5H3,(H,18,21)(H,19,20) |
| InChIKey | CHFNOXQNBYZUIE-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 95.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|