C13H24F6N2O5Si — CID 140787363
[3-(difluoroamino)-2,2,3,3-tetrafluoropropyl] N-(3-triethoxysilylpropyl)carbamate (PubChem CID 140787363) has the molecular formula C13H24F6N2O5Si and a molecular weight of 430.42 g/mol. Its IUPAC name is [3-(difluoroamino)-2,2,3,3-tetrafluoropropyl] N-(3-triethoxysilylpropyl)carbamate.
| Compound Name | [3-(difluoroamino)-2,2,3,3-tetrafluoropropyl] N-(3-triethoxysilylpropyl)carbamate |
|---|---|
| PubChem CID | 140787363 |
| Molecular Formula | C13H24F6N2O5Si |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | [3-(difluoroamino)-2,2,3,3-tetrafluoropropyl] N-(3-triethoxysilylpropyl)carbamate |
| SMILES | CCO[Si](CCCNC(=O)OCC(F)(F)C(F)(F)N(F)F)(OCC)OCC |
| InChI | InChI=1S/C13H24F6N2O5Si/c1-4-24-27(25-5-2,26-6-3)9-7-8-20-11(22)23-10-12(14,15)13(16,17)21(18)19/h4-10H2,1-3H3,(H,20,22) |
| InChIKey | LMCYOIIJKRYJGA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 69.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|