C16H42O9Si5 — CID 158389436
methane;2,2,4,6,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;3-trimethoxysilylpropyl 2-methylprop-2-enoate (PubChem CID 158389436) has the molecular formula C16H42O9Si5 and a molecular weight of 518.93 g/mol. Its IUPAC name is methane;2,2,4,6,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;3-trimethoxysilylpropyl 2-methylprop-2-enoate.
| Compound Name | methane;2,2,4,6,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 158389436 |
| Molecular Formula | C16H42O9Si5 |
| Molecular Weight | 518.93 g/mol |
| Exact Mass | 518.17 |
| IUPAC Name | methane;2,2,4,6,8-pentamethyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocane;3-trimethoxysilylpropyl 2-methylprop-2-enoate |
| SMILES | C.C=C(C)C(=O)OCCC[Si](OC)(OC)OC.C[SiH]1O[SiH](C)O[Si](C)(C)O[SiH](C)O1 |
| InChI | InChI=1S/C10H20O5Si.C5H18O4Si4.CH4/c1-9(2)10(11)15-7-6-8-16(12-3,13-4)14-5;1-10-6-11(2)8-13(4,5)9-12(3)7-10;/h1,6-8H2,2-5H3;10-12H,1-5H3;1H4 |
| InChIKey | GWTPYQWPIUDTMZ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 90.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.93 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|