C23H40O9Si — CID 175369896
[4-[dimethoxy-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy-7-(oxiran-2-ylmethoxy)heptyl] 2-methylprop-2-enoate (PubChem CID 175369896) has the molecular formula C23H40O9Si and a molecular weight of 488.65 g/mol. Its IUPAC name is [4-[dimethoxy-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy-7-(oxiran-2-ylmethoxy)heptyl] 2-methylprop-2-enoate.
| Compound Name | [4-[dimethoxy-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy-7-(oxiran-2-ylmethoxy)heptyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175369896 |
| Molecular Formula | C23H40O9Si |
| Molecular Weight | 488.65 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | [4-[dimethoxy-[3-(2-methylprop-2-enoyloxy)propyl]silyl]oxy-7-(oxiran-2-ylmethoxy)heptyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(CCCOCC1CO1)O[Si](CCCOC(=O)C(=C)C)(OC)OC |
| InChI | InChI=1S/C23H40O9Si/c1-18(2)22(24)29-13-8-11-20(10-7-12-28-16-21-17-31-21)32-33(26-5,27-6)15-9-14-30-23(25)19(3)4/h20-21H,1,3,7-17H2,2,4-6H3 |
| InChIKey | PYSMAQTVOMJOLP-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 102.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.65 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|