C24H46O11Si2 — CID 88618101
3-(oxiran-2-ylmethoxy)propyl tris(prop-1-en-2-yl) silicate;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 88618101) has the molecular formula C24H46O11Si2 and a molecular weight of 566.79 g/mol. Its IUPAC name is 3-(oxiran-2-ylmethoxy)propyl tris(prop-1-en-2-yl) silicate;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | 3-(oxiran-2-ylmethoxy)propyl tris(prop-1-en-2-yl) silicate;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 88618101 |
| Molecular Formula | C24H46O11Si2 |
| Molecular Weight | 566.79 g/mol |
| Exact Mass | 566.26 |
| IUPAC Name | 3-(oxiran-2-ylmethoxy)propyl tris(prop-1-en-2-yl) silicate;trimethoxy-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | C=C(C)O[Si](OCCCOCC1CO1)(OC(=C)C)OC(=C)C.CO[Si](CCCOCC1CO1)(OC)OC |
| InChI | InChI=1S/C15H26O6Si.C9H20O5Si/c1-12(2)19-22(20-13(3)4,21-14(5)6)18-9-7-8-16-10-15-11-17-15;1-10-15(11-2,12-3)6-4-5-13-7-9-8-14-9/h15H,1,3,5,7-11H2,2,4,6H3;9H,4-8H2,1-3H3 |
| InChIKey | OMAJJABMBILYFH-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 108.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.79 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|