C18H36O9Si — CID 150839011
1,1-dimethoxyethoxy-methoxy-[4-(oxiran-2-ylmethoxy)butoxy]-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 150839011) has the molecular formula C18H36O9Si and a molecular weight of 424.56 g/mol. Its IUPAC name is 1,1-dimethoxyethoxy-methoxy-[4-(oxiran-2-ylmethoxy)butoxy]-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | 1,1-dimethoxyethoxy-methoxy-[4-(oxiran-2-ylmethoxy)butoxy]-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 150839011 |
| Molecular Formula | C18H36O9Si |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | 1,1-dimethoxyethoxy-methoxy-[4-(oxiran-2-ylmethoxy)butoxy]-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | COC(C)(OC)O[Si](CCCOCC1CO1)(OC)OCCCCOCC1CO1 |
| InChI | InChI=1S/C18H36O9Si/c1-18(19-2,20-3)27-28(21-4,11-7-9-23-13-17-15-25-17)26-10-6-5-8-22-12-16-14-24-16/h16-17H,5-15H2,1-4H3 |
| InChIKey | KNOVDZJUNGQMAN-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 89.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|