C18H26O5Si — CID 141450490
dimethoxy-[3-(oxiran-2-ylmethoxy)propyl]-(2-phenylbut-3-yn-2-yloxy)silane (PubChem CID 141450490) has the molecular formula C18H26O5Si and a molecular weight of 350.49 g/mol. Its IUPAC name is dimethoxy-[3-(oxiran-2-ylmethoxy)propyl]-(2-phenylbut-3-yn-2-yloxy)silane.
| Compound Name | dimethoxy-[3-(oxiran-2-ylmethoxy)propyl]-(2-phenylbut-3-yn-2-yloxy)silane |
|---|---|
| PubChem CID | 141450490 |
| Molecular Formula | C18H26O5Si |
| Molecular Weight | 350.49 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | dimethoxy-[3-(oxiran-2-ylmethoxy)propyl]-(2-phenylbut-3-yn-2-yloxy)silane |
| SMILES | C#CC(C)(O[Si](CCCOCC1CO1)(OC)OC)c1ccccc1 |
| InChI | InChI=1S/C18H26O5Si/c1-5-18(2,16-10-7-6-8-11-16)23-24(19-3,20-4)13-9-12-21-14-17-15-22-17/h1,6-8,10-11,17H,9,12-15H2,2-4H3 |
| InChIKey | MUFQFYWTUSKRGL-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.49 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|