C11H24O6Si — CID 175592610
diethyl methyl 3-(oxiran-2-ylmethoxy)propyl silicate (PubChem CID 175592610) has the molecular formula C11H24O6Si and a molecular weight of 280.39 g/mol. Its IUPAC name is diethyl methyl 3-(oxiran-2-ylmethoxy)propyl silicate.
| Compound Name | diethyl methyl 3-(oxiran-2-ylmethoxy)propyl silicate |
|---|---|
| PubChem CID | 175592610 |
| Molecular Formula | C11H24O6Si |
| Molecular Weight | 280.39 g/mol |
| Exact Mass | 280.13 |
| IUPAC Name | diethyl methyl 3-(oxiran-2-ylmethoxy)propyl silicate |
| SMILES | CCO[Si](OC)(OCC)OCCCOCC1CO1 |
| InChI | InChI=1S/C11H24O6Si/c1-4-15-18(12-3,16-5-2)17-8-6-7-13-9-11-10-14-11/h11H,4-10H2,1-3H3 |
| InChIKey | BWMZEAFODUVKDW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 58.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.39 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|