C16H34O9Si2 — CID 22222916
[methoxy-bis[3-(oxiran-2-ylmethoxy)propyl]silyl] trimethyl silicate (PubChem CID 22222916) has the molecular formula C16H34O9Si2 and a molecular weight of 426.61 g/mol. Its IUPAC name is [methoxy-bis[3-(oxiran-2-ylmethoxy)propyl]silyl] trimethyl silicate.
| Compound Name | [methoxy-bis[3-(oxiran-2-ylmethoxy)propyl]silyl] trimethyl silicate |
|---|---|
| PubChem CID | 22222916 |
| Molecular Formula | C16H34O9Si2 |
| Molecular Weight | 426.61 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | [methoxy-bis[3-(oxiran-2-ylmethoxy)propyl]silyl] trimethyl silicate |
| SMILES | CO[Si](CCCOCC1CO1)(CCCOCC1CO1)O[Si](OC)(OC)OC |
| InChI | InChI=1S/C16H34O9Si2/c1-17-26(25-27(18-2,19-3)20-4,9-5-7-21-11-15-13-23-15)10-6-8-22-12-16-14-24-16/h15-16H,5-14H2,1-4H3 |
| InChIKey | AHMPCKOYAZBKPJ-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.61 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|