C22H52O10Si5 — CID 123458935
[dimethyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilyl] [dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl] dimethyl silicate (PubChem CID 123458935) has the molecular formula C22H52O10Si5 and a molecular weight of 617.08 g/mol. Its IUPAC name is [dimethyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilyl] [dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl] dimethyl silicate.
| Compound Name | [dimethyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilyl] [dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl] dimethyl silicate |
|---|---|
| PubChem CID | 123458935 |
| Molecular Formula | C22H52O10Si5 |
| Molecular Weight | 617.08 g/mol |
| Exact Mass | 616.24 |
| IUPAC Name | [dimethyl-[methyl-[3-(oxiran-2-ylmethoxy)propyl]-trimethylsilyloxysilyl]oxysilyl] [dimethyl-[3-(oxiran-2-ylmethoxy)propyl]silyl] dimethyl silicate |
| SMILES | CO[Si](OC)(O[Si](C)(C)CCCOCC1CO1)O[Si](C)(C)O[Si](C)(CCCOCC1CO1)O[Si](C)(C)C |
| InChI | InChI=1S/C22H52O10Si5/c1-23-37(24-2,30-34(6,7)15-11-13-25-17-21-19-27-21)32-35(8,9)31-36(10,29-33(3,4)5)16-12-14-26-18-22-20-28-22/h21-22H,11-20H2,1-10H3 |
| InChIKey | SOKBMPKRRSVSFZ-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 98.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.08 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|