C15H38O5Si4 — CID 162117066
dimethylsilylmethoxy-[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane (PubChem CID 162117066) has the molecular formula C15H38O5Si4 and a molecular weight of 410.81 g/mol. Its IUPAC name is dimethylsilylmethoxy-[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane.
| Compound Name | dimethylsilylmethoxy-[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane |
|---|---|
| PubChem CID | 162117066 |
| Molecular Formula | C15H38O5Si4 |
| Molecular Weight | 410.81 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | dimethylsilylmethoxy-[dimethyl(trimethylsilyloxy)silyl]oxy-methyl-[3-(oxiran-2-ylmethoxy)propyl]silane |
| SMILES | C[SiH](C)CO[Si](C)(CCCOCC1CO1)O[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H38O5Si4/c1-21(2)14-18-24(8,11-9-10-16-12-15-13-17-15)20-23(6,7)19-22(3,4)5/h15,21H,9-14H2,1-8H3 |
| InChIKey | YJXDRFCMBWKDQB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 49.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.81 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|